C23H26N2O5 — CID 171912720
4-ethyl-7-[1-[4-(furan-2-ylmethyl)piperazin-1-yl]-1-oxopropan-2-yl]oxychromen-2-one (PubChem CID 171912720) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-ethyl-7-[1-[4-(furan-2-ylmethyl)piperazin-1-yl]-1-oxopropan-2-yl]oxychromen-2-one.
| Compound Name | 4-ethyl-7-[1-[4-(furan-2-ylmethyl)piperazin-1-yl]-1-oxopropan-2-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 171912720 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 4-ethyl-7-[1-[4-(furan-2-ylmethyl)piperazin-1-yl]-1-oxopropan-2-yl]oxychromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(OC(C)C(=O)N3CCN(Cc4ccco4)CC3)ccc12 |
| InChI | InChI=1S/C23H26N2O5/c1-3-17-13-22(26)30-21-14-18(6-7-20(17)21)29-16(2)23(27)25-10-8-24(9-11-25)15-19-5-4-12-28-19/h4-7,12-14,16H,3,8-11,15H2,1-2H3 |
| InChIKey | KSLXLPBPBCTQPZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|