C22H29N3O5 — CID 171386982
2-[4-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanoyl]piperazin-1-yl]-N,N-dimethylacetamide (PubChem CID 171386982) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[4-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanoyl]piperazin-1-yl]-N,N-dimethylacetamide.
| Compound Name | 2-[4-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanoyl]piperazin-1-yl]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 171386982 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 2-[4-[2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanoyl]piperazin-1-yl]-N,N-dimethylacetamide |
| SMILES | Cc1c(C)c2ccc(OC(C)C(=O)N3CCN(CC(=O)N(C)C)CC3)cc2oc1=O |
| InChI | InChI=1S/C22H29N3O5/c1-14-15(2)22(28)30-19-12-17(6-7-18(14)19)29-16(3)21(27)25-10-8-24(9-11-25)13-20(26)23(4)5/h6-7,12,16H,8-11,13H2,1-5H3 |
| InChIKey | GWGMEEZZJIIHMJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 83.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|