C19H26N2O4 — CID 4908121
N-[3-(dimethylamino)propyl]-2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanamide (PubChem CID 4908121) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 4908121 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-(3,4-dimethyl-2-oxochromen-7-yl)oxypropanamide |
| SMILES | Cc1c(C)c2ccc(OC(C)C(=O)NCCCN(C)C)cc2oc1=O |
| InChI | InChI=1S/C19H26N2O4/c1-12-13(2)19(23)25-17-11-15(7-8-16(12)17)24-14(3)18(22)20-9-6-10-21(4)5/h7-8,11,14H,6,9-10H2,1-5H3,(H,20,22) |
| InChIKey | CAFFPZSSRIWULG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|