C16H19NO5 — CID 4901618
2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-(3-hydroxypropyl)acetamide (PubChem CID 4901618) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 4901618 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N-(3-hydroxypropyl)acetamide |
| SMILES | Cc1c(C)c2ccc(OCC(=O)NCCCO)cc2oc1=O |
| InChI | InChI=1S/C16H19NO5/c1-10-11(2)16(20)22-14-8-12(4-5-13(10)14)21-9-15(19)17-6-3-7-18/h4-5,8,18H,3,6-7,9H2,1-2H3,(H,17,19) |
| InChIKey | JJBJGIBLEJOSGX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|