C18H19NO8 — CID 71949431
2-[[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]amino]pentanedioic acid (PubChem CID 71949431) has the molecular formula C18H19NO8 and a molecular weight of 377.35 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 71949431 |
| Molecular Formula | C18H19NO8 |
| Molecular Weight | 377.35 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-[[2-(3,4-dimethyl-2-oxochromen-7-yl)oxyacetyl]amino]pentanedioic acid |
| SMILES | Cc1c(C)c2ccc(OCC(=O)NC(CCC(=O)O)C(=O)O)cc2oc1=O |
| InChI | InChI=1S/C18H19NO8/c1-9-10(2)18(25)27-14-7-11(3-4-12(9)14)26-8-15(20)19-13(17(23)24)5-6-16(21)22/h3-4,7,13H,5-6,8H2,1-2H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | YMXKOWRFMPMQQY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|