C24H32NO6- — CID 7083970
(2S)-2-[[2-(3-hexyl-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]hexanoate (PubChem CID 7083970) has the molecular formula C24H32NO6- and a molecular weight of 430.52 g/mol. Its IUPAC name is (2S)-2-[[2-(3-hexyl-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]hexanoate.
| Compound Name | (2S)-2-[[2-(3-hexyl-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]hexanoate |
|---|---|
| PubChem CID | 7083970 |
| Molecular Formula | C24H32NO6- |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2S)-2-[[2-(3-hexyl-4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]hexanoate |
| SMILES | CCCCCCc1c(C)c2ccc(OCC(=O)N[C@@H](CCCC)C(=O)[O-])cc2oc1=O |
| InChI | InChI=1S/C24H33NO6/c1-4-6-8-9-10-19-16(3)18-13-12-17(14-21(18)31-24(19)29)30-15-22(26)25-20(23(27)28)11-7-5-2/h12-14,20H,4-11,15H2,1-3H3,(H,25,26)(H,27,28)/p-1/t20-/m0/s1 |
| InChIKey | CPRSRMRUJNBZRN-FQEVSTJZSA-M |
| XLogP | 3.03 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|