C19H23O5- — CID 7101778
(2S)-2-(4-methyl-2-oxo-3-pentylchromen-7-yl)oxybutanoate (PubChem CID 7101778) has the molecular formula C19H23O5- and a molecular weight of 331.39 g/mol. Its IUPAC name is (2S)-2-(4-methyl-2-oxo-3-pentylchromen-7-yl)oxybutanoate.
| Compound Name | (2S)-2-(4-methyl-2-oxo-3-pentylchromen-7-yl)oxybutanoate |
|---|---|
| PubChem CID | 7101778 |
| Molecular Formula | C19H23O5- |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (2S)-2-(4-methyl-2-oxo-3-pentylchromen-7-yl)oxybutanoate |
| SMILES | CCCCCc1c(C)c2ccc(O[C@@H](CC)C(=O)[O-])cc2oc1=O |
| InChI | InChI=1S/C19H24O5/c1-4-6-7-8-15-12(3)14-10-9-13(11-17(14)24-19(15)22)23-16(5-2)18(20)21/h9-11,16H,4-8H2,1-3H3,(H,20,21)/p-1/t16-/m0/s1 |
| InChIKey | ANOQLUYMPCZOPM-INIZCTEOSA-M |
| XLogP | 2.74 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|