C16H18O5 — CID 3645981
2-(4-methyl-2-oxo-3-propylchromen-7-yl)oxypropanoic acid (PubChem CID 3645981) has the molecular formula C16H18O5 and a molecular weight of 290.31 g/mol. Its IUPAC name is 2-(4-methyl-2-oxo-3-propylchromen-7-yl)oxypropanoic acid.
| Compound Name | 2-(4-methyl-2-oxo-3-propylchromen-7-yl)oxypropanoic acid |
|---|---|
| PubChem CID | 3645981 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(4-methyl-2-oxo-3-propylchromen-7-yl)oxypropanoic acid |
| SMILES | CCCc1c(C)c2ccc(OC(C)C(=O)O)cc2oc1=O |
| InChI | InChI=1S/C16H18O5/c1-4-5-13-9(2)12-7-6-11(20-10(3)15(17)18)8-14(12)21-16(13)19/h6-8,10H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | MTPBMABINRMNSM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|