C17H19O5- — CID 6922533
(2S)-2-[4-methyl-3-(2-methylpropyl)-2-oxochromen-7-yl]oxypropanoate (PubChem CID 6922533) has the molecular formula C17H19O5- and a molecular weight of 303.33 g/mol. Its IUPAC name is (2S)-2-[4-methyl-3-(2-methylpropyl)-2-oxochromen-7-yl]oxypropanoate.
| Compound Name | (2S)-2-[4-methyl-3-(2-methylpropyl)-2-oxochromen-7-yl]oxypropanoate |
|---|---|
| PubChem CID | 6922533 |
| Molecular Formula | C17H19O5- |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | (2S)-2-[4-methyl-3-(2-methylpropyl)-2-oxochromen-7-yl]oxypropanoate |
| SMILES | Cc1c(CC(C)C)c(=O)oc2cc(O[C@@H](C)C(=O)[O-])ccc12 |
| InChI | InChI=1S/C17H20O5/c1-9(2)7-14-10(3)13-6-5-12(21-11(4)16(18)19)8-15(13)22-17(14)20/h5-6,8-9,11H,7H2,1-4H3,(H,18,19)/p-1/t11-/m0/s1 |
| InChIKey | SBOVCAKWTFKELI-NSHDSACASA-M |
| XLogP | 1.82 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|