C17H19NO6 — CID 4668968
2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]pentanoic acid (PubChem CID 4668968) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]pentanoic acid.
| Compound Name | 2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 4668968 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]pentanoic acid |
| SMILES | CCCC(NC(=O)COc1ccc2c(C)cc(=O)oc2c1)C(=O)O |
| InChI | InChI=1S/C17H19NO6/c1-3-4-13(17(21)22)18-15(19)9-23-11-5-6-12-10(2)7-16(20)24-14(12)8-11/h5-8,13H,3-4,9H2,1-2H3,(H,18,19)(H,21,22) |
| InChIKey | RWZVDRODCAYCMG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|