C21H20N2O6 — CID 19166677
N'-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-2-(4-methylphenoxy)acetohydrazide (PubChem CID 19166677) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is N'-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-2-(4-methylphenoxy)acetohydrazide.
| Compound Name | N'-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-2-(4-methylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 19166677 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N'-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]-2-(4-methylphenoxy)acetohydrazide |
| SMILES | Cc1ccc(OCC(=O)NNC(=O)COc2ccc3c(C)cc(=O)oc3c2)cc1 |
| InChI | InChI=1S/C21H20N2O6/c1-13-3-5-15(6-4-13)27-11-19(24)22-23-20(25)12-28-16-7-8-17-14(2)9-21(26)29-18(17)10-16/h3-10H,11-12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | WKRVKPDJIMTXHP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|