C23H22N2O7 — CID 73399461
2-[2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]propanoylamino]-2-phenylacetic acid (PubChem CID 73399461) has the molecular formula C23H22N2O7 and a molecular weight of 438.44 g/mol. Its IUPAC name is 2-[2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]propanoylamino]-2-phenylacetic acid.
| Compound Name | 2-[2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]propanoylamino]-2-phenylacetic acid |
|---|---|
| PubChem CID | 73399461 |
| Molecular Formula | C23H22N2O7 |
| Molecular Weight | 438.44 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 2-[2-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]amino]propanoylamino]-2-phenylacetic acid |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)NC(C)C(=O)NC(C(=O)O)c3ccccc3)ccc12 |
| InChI | InChI=1S/C23H22N2O7/c1-13-10-20(27)32-18-11-16(8-9-17(13)18)31-12-19(26)24-14(2)22(28)25-21(23(29)30)15-6-4-3-5-7-15/h3-11,14,21H,12H2,1-2H3,(H,24,26)(H,25,28)(H,29,30) |
| InChIKey | QHHBVIGRDJSDLL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|