C20H17Cl2NO4 — CID 42900895
N-[1-(3,4-dichlorophenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 42900895) has the molecular formula C20H17Cl2NO4 and a molecular weight of 406.27 g/mol. Its IUPAC name is N-[1-(3,4-dichlorophenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 42900895 |
| Molecular Formula | C20H17Cl2NO4 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-[1-(3,4-dichlorophenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)NC(C)c3ccc(Cl)c(Cl)c3)ccc12 |
| InChI | InChI=1S/C20H17Cl2NO4/c1-11-7-20(25)27-18-9-14(4-5-15(11)18)26-10-19(24)23-12(2)13-3-6-16(21)17(22)8-13/h3-9,12H,10H2,1-2H3,(H,23,24) |
| InChIKey | DHOJOHVIDLVQGP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|