C24H27NO6 — CID 7936502
N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide (PubChem CID 7936502) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide.
| Compound Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 7936502 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-2-(4-methyl-2-oxochromen-7-yl)oxyacetamide |
| SMILES | CCOc1ccc([C@@H](C)NC(=O)COc2ccc3c(C)cc(=O)oc3c2)cc1OCC |
| InChI | InChI=1S/C24H27NO6/c1-5-28-20-10-7-17(12-22(20)29-6-2)16(4)25-23(26)14-30-18-8-9-19-15(3)11-24(27)31-21(19)13-18/h7-13,16H,5-6,14H2,1-4H3,(H,25,26)/t16-/m1/s1 |
| InChIKey | JWNQYWGKQUBMTA-MRXNPFEDSA-N |
| XLogP | 4.16 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|