C25H23NO4 — CID 7699880
2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[(1S)-1-naphthalen-2-ylethyl]acetamide (PubChem CID 7699880) has the molecular formula C25H23NO4 and a molecular weight of 401.46 g/mol. Its IUPAC name is 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[(1S)-1-naphthalen-2-ylethyl]acetamide.
| Compound Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
|---|---|
| PubChem CID | 7699880 |
| Molecular Formula | C25H23NO4 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[(1S)-1-naphthalen-2-ylethyl]acetamide |
| SMILES | CCc1cc(=O)oc2cc(OCC(=O)N[C@@H](C)c3ccc4ccccc4c3)ccc12 |
| InChI | InChI=1S/C25H23NO4/c1-3-17-13-25(28)30-23-14-21(10-11-22(17)23)29-15-24(27)26-16(2)19-9-8-18-6-4-5-7-20(18)12-19/h4-14,16H,3,15H2,1-2H3,(H,26,27)/t16-/m0/s1 |
| InChIKey | SYDMNNYWZFTFEB-INIZCTEOSA-N |
| XLogP | 4.76 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|