C20H24N4O4 — CID 171915665
2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]acetamide (PubChem CID 171915665) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]acetamide.
| Compound Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 171915665 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[1-(4-propan-2-yl-1,2,4-triazol-3-yl)ethyl]acetamide |
| SMILES | CCc1cc(=O)oc2cc(OCC(=O)NC(C)c3nncn3C(C)C)ccc12 |
| InChI | InChI=1S/C20H24N4O4/c1-5-14-8-19(26)28-17-9-15(6-7-16(14)17)27-10-18(25)22-13(4)20-23-21-11-24(20)12(2)3/h6-9,11-13H,5,10H2,1-4H3,(H,22,25) |
| InChIKey | YZGONGDLJPTLKK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|