C17H20N2O5 — CID 41402767
2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(propylcarbamoyl)acetamide (PubChem CID 41402767) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(propylcarbamoyl)acetamide.
| Compound Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(propylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 41402767 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(propylcarbamoyl)acetamide |
| SMILES | CCCNC(=O)NC(=O)COc1ccc2c(CC)cc(=O)oc2c1 |
| InChI | InChI=1S/C17H20N2O5/c1-3-7-18-17(22)19-15(20)10-23-12-5-6-13-11(4-2)8-16(21)24-14(13)9-12/h5-6,8-9H,3-4,7,10H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | JDBGBCAWHWHBGI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|