C22H22N2O5 — CID 8636135
N-(butylcarbamoyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide (PubChem CID 8636135) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide.
| Compound Name | N-(butylcarbamoyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 8636135 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | N-(butylcarbamoyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
| SMILES | CCCCNC(=O)NC(=O)COc1ccc2c(-c3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H22N2O5/c1-2-3-11-23-22(27)24-20(25)14-28-16-9-10-17-18(15-7-5-4-6-8-15)13-21(26)29-19(17)12-16/h4-10,12-13H,2-3,11,14H2,1H3,(H2,23,24,25,27) |
| InChIKey | FXWGSUPRAHWCPP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|