C25H16N2O6 — CID 155543658
N-(1,3-dioxoisoindol-2-yl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide (PubChem CID 155543658) has the molecular formula C25H16N2O6 and a molecular weight of 440.41 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-2-yl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide.
| Compound Name | N-(1,3-dioxoisoindol-2-yl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 155543658 |
| Molecular Formula | C25H16N2O6 |
| Molecular Weight | 440.41 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | N-(1,3-dioxoisoindol-2-yl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2c(-c3ccccc3)cc(=O)oc2c1)NN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H16N2O6/c28-22(26-27-24(30)18-8-4-5-9-19(18)25(27)31)14-32-16-10-11-17-20(15-6-2-1-3-7-15)13-23(29)33-21(17)12-16/h1-13H,14H2,(H,26,28) |
| InChIKey | YUBBCSZIZQIZPQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|