C26H21NO6 — CID 1194304
(2S)-2-[[2-(2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]-3-phenylpropanoic acid (PubChem CID 1194304) has the molecular formula C26H21NO6 and a molecular weight of 443.46 g/mol. Its IUPAC name is (2S)-2-[[2-(2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-(2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 1194304 |
| Molecular Formula | C26H21NO6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (2S)-2-[[2-(2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(COc1ccc2c(-c3ccccc3)cc(=O)oc2c1)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H21NO6/c28-24(27-22(26(30)31)13-17-7-3-1-4-8-17)16-32-19-11-12-20-21(18-9-5-2-6-10-18)15-25(29)33-23(20)14-19/h1-12,14-15,22H,13,16H2,(H,27,28)(H,30,31)/t22-/m0/s1 |
| InChIKey | GUXSBJFILJLILM-QFIPXVFZSA-N |
| XLogP | 3.65 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|