C27H23NO6 — CID 1194318
(2R)-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 1194318) has the molecular formula C27H23NO6 and a molecular weight of 457.48 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 1194318 |
| Molecular Formula | C27H23NO6 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (2R)-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | C[C@@H](Oc1ccc2c(-c3ccccc3)cc(=O)oc2c1)C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H23NO6/c1-17(26(30)28-23(27(31)32)14-18-8-4-2-5-9-18)33-20-12-13-21-22(19-10-6-3-7-11-19)16-25(29)34-24(21)15-20/h2-13,15-17,23H,14H2,1H3,(H,28,30)(H,31,32)/t17-,23-/m1/s1 |
| InChIKey | DPLGBTLDCZDSIR-UZUQRXQVSA-N |
| XLogP | 4.04 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|