C26H20NO6- — CID 7896865
(2R)-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]-2-phenylacetate (PubChem CID 7896865) has the molecular formula C26H20NO6- and a molecular weight of 442.45 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]-2-phenylacetate.
| Compound Name | (2R)-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 7896865 |
| Molecular Formula | C26H20NO6- |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (2R)-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]-2-phenylacetate |
| SMILES | C[C@@H](Oc1ccc2c(-c3ccccc3)cc(=O)oc2c1)C(=O)N[C@@H](C(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C26H21NO6/c1-16(25(29)27-24(26(30)31)18-10-6-3-7-11-18)32-19-12-13-20-21(17-8-4-2-5-9-17)15-23(28)33-22(20)14-19/h2-16,24H,1H3,(H,27,29)(H,30,31)/p-1/t16-,24-/m1/s1 |
| InChIKey | OZBPVMCJZLVYJH-VOIUYBSRSA-M |
| XLogP | 2.83 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|