C24H24NO6- — CID 7076845
(2R,3S)-3-methyl-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]pentanoate (PubChem CID 7076845) has the molecular formula C24H24NO6- and a molecular weight of 422.46 g/mol. Its IUPAC name is (2R,3S)-3-methyl-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]pentanoate.
| Compound Name | (2R,3S)-3-methyl-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 7076845 |
| Molecular Formula | C24H24NO6- |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (2R,3S)-3-methyl-2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]pentanoate |
| SMILES | CC[C@H](C)[C@@H](NC(=O)[C@@H](C)Oc1ccc2c(-c3ccccc3)cc(=O)oc2c1)C(=O)[O-] |
| InChI | InChI=1S/C24H25NO6/c1-4-14(2)22(24(28)29)25-23(27)15(3)30-17-10-11-18-19(16-8-6-5-7-9-16)13-21(26)31-20(18)12-17/h5-15,22H,4H2,1-3H3,(H,25,27)(H,28,29)/p-1/t14-,15+,22+/m0/s1 |
| InChIKey | HVFXWBGSLISKKU-SMASLZHESA-M |
| XLogP | 2.51 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|