C22H20N2O7 — CID 42235109
2-[[2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]acetyl]amino]acetic acid (PubChem CID 42235109) has the molecular formula C22H20N2O7 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-[[2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 42235109 |
| Molecular Formula | C22H20N2O7 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-[[2-[[(2R)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanoyl]amino]acetyl]amino]acetic acid |
| SMILES | C[C@@H](Oc1ccc2c(-c3ccccc3)cc(=O)oc2c1)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C22H20N2O7/c1-13(22(29)24-11-19(25)23-12-20(26)27)30-15-7-8-16-17(14-5-3-2-4-6-14)10-21(28)31-18(16)9-15/h2-10,13H,11-12H2,1H3,(H,23,25)(H,24,29)(H,26,27)/t13-/m1/s1 |
| InChIKey | XYHGBQOWOKTEFX-CYBMUJFWSA-N |
| XLogP | 1.54 |
| TPSA | 134.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|