C24H20N2O4 — CID 7070060
(2S)-2-(2-oxo-4-phenylchromen-7-yl)oxy-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 7070060) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is (2S)-2-(2-oxo-4-phenylchromen-7-yl)oxy-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-(2-oxo-4-phenylchromen-7-yl)oxy-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 7070060 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (2S)-2-(2-oxo-4-phenylchromen-7-yl)oxy-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | C[C@H](Oc1ccc2c(-c3ccccc3)cc(=O)oc2c1)C(=O)NCc1ccccn1 |
| InChI | InChI=1S/C24H20N2O4/c1-16(24(28)26-15-18-9-5-6-12-25-18)29-19-10-11-20-21(17-7-3-2-4-8-17)14-23(27)30-22(20)13-19/h2-14,16H,15H2,1H3,(H,26,28)/t16-/m0/s1 |
| InChIKey | WNQNTECUIRKYRA-INIZCTEOSA-N |
| XLogP | 3.94 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|