C24H27N2O5+ — CID 7633293
(2S)-N-(2-morpholin-4-ium-4-ylethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanamide (PubChem CID 7633293) has the molecular formula C24H27N2O5+ and a molecular weight of 423.49 g/mol. Its IUPAC name is (2S)-N-(2-morpholin-4-ium-4-ylethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanamide.
| Compound Name | (2S)-N-(2-morpholin-4-ium-4-ylethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 7633293 |
| Molecular Formula | C24H27N2O5+ |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (2S)-N-(2-morpholin-4-ium-4-ylethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxypropanamide |
| SMILES | C[C@H](Oc1ccc2c(-c3ccccc3)cc(=O)oc2c1)C(=O)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C24H26N2O5/c1-17(24(28)25-9-10-26-11-13-29-14-12-26)30-19-7-8-20-21(18-5-3-2-4-6-18)16-23(27)31-22(20)15-19/h2-8,15-17H,9-14H2,1H3,(H,25,28)/p+1/t17-/m0/s1 |
| InChIKey | RUNJEDIDWGMGLU-KRWDZBQOSA-O |
| XLogP | 1.26 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|