C23H25N2O5+ — CID 7633718
N-(2-morpholin-4-ium-4-ylethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide (PubChem CID 7633718) has the molecular formula C23H25N2O5+ and a molecular weight of 409.46 g/mol. Its IUPAC name is N-(2-morpholin-4-ium-4-ylethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide.
| Compound Name | N-(2-morpholin-4-ium-4-ylethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 7633718 |
| Molecular Formula | C23H25N2O5+ |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | N-(2-morpholin-4-ium-4-ylethyl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
| SMILES | O=C(COc1ccc2c(-c3ccccc3)cc(=O)oc2c1)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C23H24N2O5/c26-22(24-8-9-25-10-12-28-13-11-25)16-29-18-6-7-19-20(17-4-2-1-3-5-17)15-23(27)30-21(19)14-18/h1-7,14-15H,8-13,16H2,(H,24,26)/p+1 |
| InChIKey | LROZLOXDLXIOFD-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|