C23H19NO4S — CID 8951439
2-(2-oxo-4-phenylchromen-7-yl)oxy-N-(2-thiophen-2-ylethyl)acetamide (PubChem CID 8951439) has the molecular formula C23H19NO4S and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-(2-oxo-4-phenylchromen-7-yl)oxy-N-(2-thiophen-2-ylethyl)acetamide.
| Compound Name | 2-(2-oxo-4-phenylchromen-7-yl)oxy-N-(2-thiophen-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 8951439 |
| Molecular Formula | C23H19NO4S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | 2-(2-oxo-4-phenylchromen-7-yl)oxy-N-(2-thiophen-2-ylethyl)acetamide |
| SMILES | O=C(COc1ccc2c(-c3ccccc3)cc(=O)oc2c1)NCCc1cccs1 |
| InChI | InChI=1S/C23H19NO4S/c25-22(24-11-10-18-7-4-12-29-18)15-27-17-8-9-19-20(16-5-2-1-3-6-16)14-23(26)28-21(19)13-17/h1-9,12-14H,10-11,15H2,(H,24,25) |
| InChIKey | HVOBNHGJNFUJDG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|