C24H26N4O6 — CID 75490950
(2R)-5-(diaminomethylideneamino)-2-[2-(2-oxo-4-phenylchromen-7-yl)oxypropanoylamino]pentanoic acid (PubChem CID 75490950) has the molecular formula C24H26N4O6 and a molecular weight of 466.49 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[2-(2-oxo-4-phenylchromen-7-yl)oxypropanoylamino]pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[2-(2-oxo-4-phenylchromen-7-yl)oxypropanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 75490950 |
| Molecular Formula | C24H26N4O6 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[2-(2-oxo-4-phenylchromen-7-yl)oxypropanoylamino]pentanoic acid |
| SMILES | CC(Oc1ccc2c(-c3ccccc3)cc(=O)oc2c1)C(=O)N[C@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C24H26N4O6/c1-14(22(30)28-19(23(31)32)8-5-11-27-24(25)26)33-16-9-10-17-18(15-6-3-2-4-7-15)13-21(29)34-20(17)12-16/h2-4,6-7,9-10,12-14,19H,5,8,11H2,1H3,(H,28,30)(H,31,32)(H4,25,26,27)/t14?,19-/m1/s1 |
| InChIKey | SMROCEATAOXDCX-JANGERMGSA-N |
| XLogP | 1.85 |
| TPSA | 170.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|