C21H28N4O6 — CID 3607683
5-(diaminomethylideneamino)-2-[2-(2-oxo-4-propylchromen-7-yl)oxypropanoylamino]pentanoic acid (PubChem CID 3607683) has the molecular formula C21H28N4O6 and a molecular weight of 432.48 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[2-(2-oxo-4-propylchromen-7-yl)oxypropanoylamino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[2-(2-oxo-4-propylchromen-7-yl)oxypropanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 3607683 |
| Molecular Formula | C21H28N4O6 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[2-(2-oxo-4-propylchromen-7-yl)oxypropanoylamino]pentanoic acid |
| SMILES | CCCc1cc(=O)oc2cc(OC(C)C(=O)NC(CCCN=C(N)N)C(=O)O)ccc12 |
| InChI | InChI=1S/C21H28N4O6/c1-3-5-13-10-18(26)31-17-11-14(7-8-15(13)17)30-12(2)19(27)25-16(20(28)29)6-4-9-24-21(22)23/h7-8,10-12,16H,3-6,9H2,1-2H3,(H,25,27)(H,28,29)(H4,22,23,24) |
| InChIKey | MAQWCHLPIMCYTG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 170.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|