C21H25N3O4 — CID 40512472
(2S)-N-(3-imidazol-1-ylpropyl)-2-(2-oxo-4-propylchromen-7-yl)oxypropanamide (PubChem CID 40512472) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (2S)-N-(3-imidazol-1-ylpropyl)-2-(2-oxo-4-propylchromen-7-yl)oxypropanamide.
| Compound Name | (2S)-N-(3-imidazol-1-ylpropyl)-2-(2-oxo-4-propylchromen-7-yl)oxypropanamide |
|---|---|
| PubChem CID | 40512472 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (2S)-N-(3-imidazol-1-ylpropyl)-2-(2-oxo-4-propylchromen-7-yl)oxypropanamide |
| SMILES | CCCc1cc(=O)oc2cc(O[C@@H](C)C(=O)NCCCn3ccnc3)ccc12 |
| InChI | InChI=1S/C21H25N3O4/c1-3-5-16-12-20(25)28-19-13-17(6-7-18(16)19)27-15(2)21(26)23-8-4-10-24-11-9-22-14-24/h6-7,9,11-15H,3-5,8,10H2,1-2H3,(H,23,26)/t15-/m0/s1 |
| InChIKey | VPEIODVRTGOERN-HNNXBMFYSA-N |
| XLogP | 2.92 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|