C19H23NO6 — CID 5106328
4-[2-(2-oxo-4-propylchromen-7-yl)oxypropanoylamino]butanoic acid (PubChem CID 5106328) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 4-[2-(2-oxo-4-propylchromen-7-yl)oxypropanoylamino]butanoic acid.
| Compound Name | 4-[2-(2-oxo-4-propylchromen-7-yl)oxypropanoylamino]butanoic acid |
|---|---|
| PubChem CID | 5106328 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 4-[2-(2-oxo-4-propylchromen-7-yl)oxypropanoylamino]butanoic acid |
| SMILES | CCCc1cc(=O)oc2cc(OC(C)C(=O)NCCCC(=O)O)ccc12 |
| InChI | InChI=1S/C19H23NO6/c1-3-5-13-10-18(23)26-16-11-14(7-8-15(13)16)25-12(2)19(24)20-9-4-6-17(21)22/h7-8,10-12H,3-6,9H2,1-2H3,(H,20,24)(H,21,22) |
| InChIKey | BYRZUFLAIAGTSN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|