C16H16NO6- — CID 6953924
2-[[(2R)-2-(4-ethyl-2-oxochromen-7-yl)oxypropanoyl]amino]acetate (PubChem CID 6953924) has the molecular formula C16H16NO6- and a molecular weight of 318.31 g/mol. Its IUPAC name is 2-[[(2R)-2-(4-ethyl-2-oxochromen-7-yl)oxypropanoyl]amino]acetate.
| Compound Name | 2-[[(2R)-2-(4-ethyl-2-oxochromen-7-yl)oxypropanoyl]amino]acetate |
|---|---|
| PubChem CID | 6953924 |
| Molecular Formula | C16H16NO6- |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-[[(2R)-2-(4-ethyl-2-oxochromen-7-yl)oxypropanoyl]amino]acetate |
| SMILES | CCc1cc(=O)oc2cc(O[C@H](C)C(=O)NCC(=O)[O-])ccc12 |
| InChI | InChI=1S/C16H17NO6/c1-3-10-6-15(20)23-13-7-11(4-5-12(10)13)22-9(2)16(21)17-8-14(18)19/h4-7,9H,3,8H2,1-2H3,(H,17,21)(H,18,19)/p-1/t9-/m1/s1 |
| InChIKey | MPRHVYQJIDBFNO-SECBINFHSA-M |
| XLogP | -0.01 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|