C22H23NO5S — CID 73256858
N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide (PubChem CID 73256858) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide.
| Compound Name | N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
|---|---|
| PubChem CID | 73256858 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(2-oxo-4-phenylchromen-7-yl)oxyacetamide |
| SMILES | CSCCC(CO)NC(=O)COc1ccc2c(-c3ccccc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H23NO5S/c1-29-10-9-16(13-24)23-21(25)14-27-17-7-8-18-19(15-5-3-2-4-6-15)12-22(26)28-20(18)11-17/h2-8,11-12,16,24H,9-10,13-14H2,1H3,(H,23,25) |
| InChIKey | UZLVXUGWEDHGIO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|