C26H20ClNO6 — CID 3653095
3-(4-chlorophenyl)-2-[[2-(2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]propanoic acid (PubChem CID 3653095) has the molecular formula C26H20ClNO6 and a molecular weight of 477.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[[2-(2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]propanoic acid.
| Compound Name | 3-(4-chlorophenyl)-2-[[2-(2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 3653095 |
| Molecular Formula | C26H20ClNO6 |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[[2-(2-oxo-4-phenylchromen-7-yl)oxyacetyl]amino]propanoic acid |
| SMILES | O=C(COc1ccc2c(-c3ccccc3)cc(=O)oc2c1)NC(Cc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C26H20ClNO6/c27-18-8-6-16(7-9-18)12-22(26(31)32)28-24(29)15-33-19-10-11-20-21(17-4-2-1-3-5-17)14-25(30)34-23(20)13-19/h1-11,13-14,22H,12,15H2,(H,28,29)(H,31,32) |
| InChIKey | PFRZCKCGMJRNLT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|