C24H25N3O8 — CID 3843774
5-(carbamoylamino)-2-[[2-[4-(4-methoxyphenyl)-2-oxochromen-7-yl]oxyacetyl]amino]pentanoic acid (PubChem CID 3843774) has the molecular formula C24H25N3O8 and a molecular weight of 483.48 g/mol. Its IUPAC name is 5-(carbamoylamino)-2-[[2-[4-(4-methoxyphenyl)-2-oxochromen-7-yl]oxyacetyl]amino]pentanoic acid.
| Compound Name | 5-(carbamoylamino)-2-[[2-[4-(4-methoxyphenyl)-2-oxochromen-7-yl]oxyacetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 3843774 |
| Molecular Formula | C24H25N3O8 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 5-(carbamoylamino)-2-[[2-[4-(4-methoxyphenyl)-2-oxochromen-7-yl]oxyacetyl]amino]pentanoic acid |
| SMILES | COc1ccc(-c2cc(=O)oc3cc(OCC(=O)NC(CCCNC(N)=O)C(=O)O)ccc23)cc1 |
| InChI | InChI=1S/C24H25N3O8/c1-33-15-6-4-14(5-7-15)18-12-22(29)35-20-11-16(8-9-17(18)20)34-13-21(28)27-19(23(30)31)3-2-10-26-24(25)32/h4-9,11-12,19H,2-3,10,13H2,1H3,(H,27,28)(H,30,31)(H3,25,26,32) |
| InChIKey | YLWNKQZQXPFSHV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|