C24H20N2O5 — CID 4965250
2-[4-(4-methoxyphenyl)-2-oxochromen-7-yl]oxy-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 4965250) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-2-oxochromen-7-yl]oxy-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[4-(4-methoxyphenyl)-2-oxochromen-7-yl]oxy-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4965250 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-2-oxochromen-7-yl]oxy-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | COc1ccc(-c2cc(=O)oc3cc(OCC(=O)NCc4cccnc4)ccc23)cc1 |
| InChI | InChI=1S/C24H20N2O5/c1-29-18-6-4-17(5-7-18)21-12-24(28)31-22-11-19(8-9-20(21)22)30-15-23(27)26-14-16-3-2-10-25-13-16/h2-13H,14-15H2,1H3,(H,26,27) |
| InChIKey | ZYUSNAILVZQUFR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|