C19H24N2O5 — CID 4904447
2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 4904447) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 4904447 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | CCc1cc(=O)oc2cc(OCC(=O)NCCN3CCOCC3)ccc12 |
| InChI | InChI=1S/C19H24N2O5/c1-2-14-11-19(23)26-17-12-15(3-4-16(14)17)25-13-18(22)20-5-6-21-7-9-24-10-8-21/h3-4,11-12H,2,5-10,13H2,1H3,(H,20,22) |
| InChIKey | QIUDOILNDBWBAT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|