C21H27N3O7 — CID 6723132
(2S)-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]-N-(2-morpholin-4-ylethyl)propanamide (PubChem CID 6723132) has the molecular formula C21H27N3O7 and a molecular weight of 433.46 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]-N-(2-morpholin-4-ylethyl)propanamide.
| Compound Name | (2S)-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]-N-(2-morpholin-4-ylethyl)propanamide |
|---|---|
| PubChem CID | 6723132 |
| Molecular Formula | C21H27N3O7 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | (2S)-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]-N-(2-morpholin-4-ylethyl)propanamide |
| SMILES | COc1ccc2c(CC(=O)N[C@@H](CO)C(=O)NCCN3CCOCC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H27N3O7/c1-29-15-2-3-16-14(11-20(27)31-18(16)12-15)10-19(26)23-17(13-25)21(28)22-4-5-24-6-8-30-9-7-24/h2-3,11-12,17,25H,4-10,13H2,1H3,(H,22,28)(H,23,26)/t17-/m0/s1 |
| InChIKey | LTMQFZARWQIWPL-KRWDZBQOSA-N |
| XLogP | -0.73 |
| TPSA | 130.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|