C22H23N3O5 — CID 155546029
N-[4-[(7-methoxy-2-oxochromen-4-yl)amino]phenyl]-2-morpholin-4-ylacetamide (PubChem CID 155546029) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[4-[(7-methoxy-2-oxochromen-4-yl)amino]phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[4-[(7-methoxy-2-oxochromen-4-yl)amino]phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 155546029 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[4-[(7-methoxy-2-oxochromen-4-yl)amino]phenyl]-2-morpholin-4-ylacetamide |
| SMILES | COc1ccc2c(Nc3ccc(NC(=O)CN4CCOCC4)cc3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H23N3O5/c1-28-17-6-7-18-19(13-22(27)30-20(18)12-17)23-15-2-4-16(5-3-15)24-21(26)14-25-8-10-29-11-9-25/h2-7,12-13,23H,8-11,14H2,1H3,(H,24,26) |
| InChIKey | LRXJPYAJXDGMTL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 93.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|