C26H35N3O4 — CID 16612050
4-(4-tert-butylphenoxy)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide (PubChem CID 16612050) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 4-(4-tert-butylphenoxy)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide.
| Compound Name | 4-(4-tert-butylphenoxy)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide |
|---|---|
| PubChem CID | 16612050 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 4-(4-tert-butylphenoxy)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]butanamide |
| SMILES | CC(C)(C)c1ccc(OCCCC(=O)Nc2ccc(NC(=O)CN3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C26H35N3O4/c1-26(2,3)20-6-12-23(13-7-20)33-16-4-5-24(30)27-21-8-10-22(11-9-21)28-25(31)19-29-14-17-32-18-15-29/h6-13H,4-5,14-19H2,1-3H3,(H,27,30)(H,28,31) |
| InChIKey | JWMWKRKILJRKMG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|