C19H19N3O4 — CID 162787858
N-(7-amino-9-oxoxanthen-3-yl)-2-morpholin-4-ylacetamide (PubChem CID 162787858) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is N-(7-amino-9-oxoxanthen-3-yl)-2-morpholin-4-ylacetamide.
| Compound Name | N-(7-amino-9-oxoxanthen-3-yl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 162787858 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-(7-amino-9-oxoxanthen-3-yl)-2-morpholin-4-ylacetamide |
| SMILES | Nc1ccc2oc3cc(NC(=O)CN4CCOCC4)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C19H19N3O4/c20-12-1-4-16-15(9-12)19(24)14-3-2-13(10-17(14)26-16)21-18(23)11-22-5-7-25-8-6-22/h1-4,9-10H,5-8,11,20H2,(H,21,23) |
| InChIKey | NOQNUOOKQAXRGK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|