C22H28N2O6 — CID 4608789
N-(cyclohexylmethyl)-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanamide (PubChem CID 4608789) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanamide.
| Compound Name | N-(cyclohexylmethyl)-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 4608789 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | N-(cyclohexylmethyl)-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanamide |
| SMILES | COc1ccc2c(CC(=O)NC(CO)C(=O)NCC3CCCCC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H28N2O6/c1-29-16-7-8-17-15(10-21(27)30-19(17)11-16)9-20(26)24-18(13-25)22(28)23-12-14-5-3-2-4-6-14/h7-8,10-11,14,18,25H,2-6,9,12-13H2,1H3,(H,23,28)(H,24,26) |
| InChIKey | KHMYDVOIPIPZCM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|