C20H24N2O6 — CID 6723110
(2S)-N-cyclopentyl-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanamide (PubChem CID 6723110) has the molecular formula C20H24N2O6 and a molecular weight of 388.42 g/mol. Its IUPAC name is (2S)-N-cyclopentyl-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanamide.
| Compound Name | (2S)-N-cyclopentyl-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 6723110 |
| Molecular Formula | C20H24N2O6 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (2S)-N-cyclopentyl-3-hydroxy-2-[[2-(7-methoxy-2-oxochromen-4-yl)acetyl]amino]propanamide |
| SMILES | COc1ccc2c(CC(=O)N[C@@H](CO)C(=O)NC3CCCC3)cc(=O)oc2c1 |
| InChI | InChI=1S/C20H24N2O6/c1-27-14-6-7-15-12(9-19(25)28-17(15)10-14)8-18(24)22-16(11-23)20(26)21-13-4-2-3-5-13/h6-7,9-10,13,16,23H,2-5,8,11H2,1H3,(H,21,26)(H,22,24)/t16-/m0/s1 |
| InChIKey | GLONRCVYJDSGAW-INIZCTEOSA-N |
| XLogP | 0.88 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|