C16H18F5N3O4 — CID 6724423
2,3,4,5,6-pentafluoro-N-[(2S)-3-hydroxy-1-(2-morpholin-4-ylethylamino)-1-oxopropan-2-yl]benzamide (PubChem CID 6724423) has the molecular formula C16H18F5N3O4 and a molecular weight of 411.33 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[(2S)-3-hydroxy-1-(2-morpholin-4-ylethylamino)-1-oxopropan-2-yl]benzamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[(2S)-3-hydroxy-1-(2-morpholin-4-ylethylamino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 6724423 |
| Molecular Formula | C16H18F5N3O4 |
| Molecular Weight | 411.33 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[(2S)-3-hydroxy-1-(2-morpholin-4-ylethylamino)-1-oxopropan-2-yl]benzamide |
| SMILES | O=C(N[C@@H](CO)C(=O)NCCN1CCOCC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C16H18F5N3O4/c17-10-9(11(18)13(20)14(21)12(10)19)16(27)23-8(7-25)15(26)22-1-2-24-3-5-28-6-4-24/h8,25H,1-7H2,(H,22,26)(H,23,27)/t8-/m0/s1 |
| InChIKey | CNOBTPMLLRGUNK-QMMMGPOBSA-N |
| XLogP | -0.08 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.33 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|