C18H23NO4 — CID 7699702
2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(3-methylbutyl)acetamide (PubChem CID 7699702) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(3-methylbutyl)acetamide.
| Compound Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 7699702 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-(3-methylbutyl)acetamide |
| SMILES | CCc1cc(=O)oc2cc(OCC(=O)NCCC(C)C)ccc12 |
| InChI | InChI=1S/C18H23NO4/c1-4-13-9-18(21)23-16-10-14(5-6-15(13)16)22-11-17(20)19-8-7-12(2)3/h5-6,9-10,12H,4,7-8,11H2,1-3H3,(H,19,20) |
| InChIKey | SVVNOHCZANNCMF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|