C23H25NO4 — CID 2695560
2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[(2R)-4-phenylbutan-2-yl]acetamide (PubChem CID 2695560) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[(2R)-4-phenylbutan-2-yl]acetamide.
| Compound Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[(2R)-4-phenylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 2695560 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-(4-ethyl-2-oxochromen-7-yl)oxy-N-[(2R)-4-phenylbutan-2-yl]acetamide |
| SMILES | CCc1cc(=O)oc2cc(OCC(=O)N[C@H](C)CCc3ccccc3)ccc12 |
| InChI | InChI=1S/C23H25NO4/c1-3-18-13-23(26)28-21-14-19(11-12-20(18)21)27-15-22(25)24-16(2)9-10-17-7-5-4-6-8-17/h4-8,11-14,16H,3,9-10,15H2,1-2H3,(H,24,25)/t16-/m1/s1 |
| InChIKey | FWMQOTJMKZMFHH-MRXNPFEDSA-N |
| XLogP | 3.87 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|