C17H21NO4 — CID 770841
2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N,N-diethylacetamide (PubChem CID 770841) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N,N-diethylacetamide.
| Compound Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N,N-diethylacetamide |
|---|---|
| PubChem CID | 770841 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-(3,4-dimethyl-2-oxochromen-7-yl)oxy-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc2c(C)c(C)c(=O)oc2c1 |
| InChI | InChI=1S/C17H21NO4/c1-5-18(6-2)16(19)10-21-13-7-8-14-11(3)12(4)17(20)22-15(14)9-13/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | WHLCWCJRNRFERW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|