C20H21NO5 — CID 1072484
N,N-diethyl-2-(8-methoxy-6-oxobenzo[c]chromen-3-yl)oxyacetamide (PubChem CID 1072484) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is N,N-diethyl-2-(8-methoxy-6-oxobenzo[c]chromen-3-yl)oxyacetamide.
| Compound Name | N,N-diethyl-2-(8-methoxy-6-oxobenzo[c]chromen-3-yl)oxyacetamide |
|---|---|
| PubChem CID | 1072484 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | N,N-diethyl-2-(8-methoxy-6-oxobenzo[c]chromen-3-yl)oxyacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc2c(c1)oc(=O)c1cc(OC)ccc12 |
| InChI | InChI=1S/C20H21NO5/c1-4-21(5-2)19(22)12-25-14-7-9-16-15-8-6-13(24-3)10-17(15)20(23)26-18(16)11-14/h6-11H,4-5,12H2,1-3H3 |
| InChIKey | AWPCPWKYCRJFOM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'coumarin_A(2)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|