C20H20O5 — CID 1332673
3-(3,3-dimethyl-2-oxobutoxy)-8-methoxybenzo[c]chromen-6-one (PubChem CID 1332673) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is 3-(3,3-dimethyl-2-oxobutoxy)-8-methoxybenzo[c]chromen-6-one.
| Compound Name | 3-(3,3-dimethyl-2-oxobutoxy)-8-methoxybenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 1332673 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-(3,3-dimethyl-2-oxobutoxy)-8-methoxybenzo[c]chromen-6-one |
| SMILES | COc1ccc2c(c1)c(=O)oc1cc(OCC(=O)C(C)(C)C)ccc12 |
| InChI | InChI=1S/C20H20O5/c1-20(2,3)18(21)11-24-13-6-8-15-14-7-5-12(23-4)9-16(14)19(22)25-17(15)10-13/h5-10H,11H2,1-4H3 |
| InChIKey | TZDUNJUJCBEFLD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'coumarin_A(2)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|